| Melting point |
143-145 °C(lit.) |
| Boiling point |
316.98°C (rough estimate) |
| Density |
1.0790 (rough estimate) |
| vapor pressure |
0Pa at 25℃ |
| refractive index |
1.6380 (estimate) |
| Flash point |
>230 °F |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| solubility |
Slightly soluble in water |
| form |
powder to crystal |
| color |
White to Almost white |
| Water Solubility |
2.75g/L at 30℃ |
| Cosmetics Ingredients Functions |
ANTIOXIDANT |
| InChI |
InChI=1S/C9H13N5/c1-6-4-2-3-5-7(6)13-9(12)14-8(10)11/h2-5H,1H3,(H6,10,11,12,13,14) |
| InChIKey |
SQZCAOHYQSOZCE-UHFFFAOYSA-N |
| SMILES |
C(=N)(NC1=CC=CC=C1C)NC(=N)N |
| LogP |
0.71 at 25℃ |
| CAS DataBase Reference |
93-69-6(CAS DataBase Reference) |
| EPA Substance Registry System |
Imidodicarbonimidic diamide, N-(2-methylphenyl)- (93-69-6) |