o-Tolyl biguanide
- Product Nameo-Tolyl biguanide
- CAS93-69-6
- CBNumberCB3300710
- MFC9H13N5
- MW191.23
- EINECS202-268-6
- MDL NumberMFCD00019731
- MOL File93-69-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 143-145 °C(lit.) |
| Boiling point | 316.98°C (rough estimate) |
| Density | 1.0790 (rough estimate) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.6380 (estimate) |
| Flash point | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Slightly soluble in water |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | 2.75g/L at 30℃ |
| Cosmetics Ingredients Functions | ANTIOXIDANT |
| InChI | InChI=1S/C9H13N5/c1-6-4-2-3-5-7(6)13-9(12)14-8(10)11/h2-5H,1H3,(H6,10,11,12,13,14) |
| InChIKey | SQZCAOHYQSOZCE-UHFFFAOYSA-N |
| SMILES | C(=N)(NC1=CC=CC=C1C)NC(=N)N |
| LogP | 0.71 at 25℃ |
| CAS DataBase Reference | 93-69-6(CAS DataBase Reference) |
| FDA UNII | 5T9Z06LCV4 |
Safety
| Symbol(GHS) |
![]()
|
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38-41 |
| Safety Statements | 26-36 |
| WGK Germany | 1 |
| RTECS | DU2800000 |
| TSCA | TSCA listed |
| HS Code | 29252900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
