| Melting point |
201-203 °C(lit.) |
| alpha |
488 º (c=0.4, CHCl3) |
| Boiling point |
399.43°C (rough estimate) |
| Density |
1.2869 (rough estimate) |
| refractive index |
1.4790 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
almost transparency in Chloroform |
| form |
powder to crystal |
| pka |
4.00±0.40(Predicted) |
| color |
Light orange to Yellow to Green |
| optical activity |
[α]25/D +488°, c = 0.7% in chloroform |
| Water Solubility |
Partly soluble in water. Soluble in acetone, ethanol, chloroform and furfural. |
| Merck |
14,9893 |
| BRN |
96698 |
| InChI |
1S/C18H16O7/c1-6-14(22)12(8(3)20)16-13(15(6)23)18(4)10(25-16)5-9(21)11(7(2)19)17(18)24/h5,22-24H,1-4H3/t18-/m1/s1 |
| InChIKey |
ICTZCAHDGHPRQR-GOSISDBHSA-N |
| SMILES |
C[C@](C1=C(O)C(C)=C(O)C(C(C)=O)=C1O2)(C(C3C(C)=O)=O)C2=CC3=O |
| LogP |
1.270 (est) |
| CAS DataBase Reference |
7562-61-0(CAS DataBase Reference) |
