| Melting point |
96° (isopropyl ether) |
| Boiling point |
373.57°C (rough estimate) |
| Density |
1.2959 (rough estimate) |
| refractive index |
1.5050 (estimate) |
| storage temp. |
2-8°C(protect from light) |
| solubility |
Practically insoluble in water, freely soluble in acetone, in ethanol (96 per cent) and in methylene chloride. |
| pka |
4.05±0.10(Predicted) |
| form |
Solid |
| color |
White to Almost white |
| λmax |
314nm(Phosphate buffer sol.)(lit.) |
| Merck |
14,9422 |
| Major Application |
pharmaceutical (small molecule) |
| InChI |
InChI=1S/C14H12O3S/c1-9(14(16)17)11-7-8-12(18-11)13(15)10-5-3-2-4-6-10/h2-9H,1H3,(H,16,17) |
| InChIKey |
GUHPRPJDBZHYCJ-UHFFFAOYSA-N |
| SMILES |
C1(=CC=C(C(C)C(=O)O)S1)C(=O)C1C=CC=CC=1 |