| Melting point |
178℃ |
| Boiling point |
375.9±42.0 °C(Predicted) |
| Density |
1.930 |
| storage temp. |
Keep in dark place,Sealed in dry,2-8°C |
| solubility |
DMSO (Slightly), Methanol (Slightly) |
| form |
Solid |
| pka |
8.24±0.70(Predicted) |
| color |
White to Gray to Red |
| Henry's Law Constant |
1.2×106 mol/(m3Pa) at 25℃, Ebert et al. (2023) |
| Major Application |
agriculture environmental |
| InChI |
InChI=1S/C13H6Br2F6N2O2S/c1-4-22-10(12(16,17)18)9(26-4)11(24)23-8-6(14)2-5(3-7(8)15)25-13(19,20)21/h2-3H,1H3,(H,23,24) |
| InChIKey |
WOSNCVAPUOFXEH-UHFFFAOYSA-N |
| SMILES |
S1C(C(NC2=C(Br)C=C(OC(F)(F)F)C=C2Br)=O)=C(C(F)(F)F)N=C1C |
| CAS DataBase Reference |
130000-40-7 |
| EPA Substance Registry System |
5-Thiazolecarboxamide, N-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-2-methyl-4-(trifluoromethyl)- (130000-40-7) |