| Melting point |
<0°C |
| Boiling point |
90 °C/3 mmHg (lit.) |
| Density |
0.831 g/mL at 25 °C (lit.) |
| refractive index |
n20/D 1.485(lit.) |
| Flash point |
171 °F |
| storage temp. |
under inert gas (nitrogen or Argon) at 2-8°C |
| form |
Liquid |
| Specific Gravity |
0.8345 |
| Appearance |
Colorless to light yellow Liquid |
| Water Solubility |
Insoluble in water. |
| Hydrolytic Sensitivity |
4: no reaction with water under neutral conditions |
| BRN |
1750943 |
| InChI |
InChI=1S/C12H20Si/c1-5-9-13(10-6-2,11-7-3)12-8-4/h5-8H,1-4,9-12H2 |
| InChIKey |
AKRQMTFHUVDMIL-UHFFFAOYSA-N |
| SMILES |
[Si](CC=C)(CC=C)(CC=C)CC=C |
| CAS DataBase Reference |
1112-66-9(CAS DataBase Reference) |
