| Melting point |
182-185°C |
| Boiling point |
581.6±50.0 °C(Predicted) |
| Density |
1.2581 (estimate) |
| storage temp. |
Sealed in dry,Store in freezer, under -20°C |
| solubility |
Very slightly soluble in water, soluble in methylene chloride, sparingly soluble in ethanol (96 per cent). It dissolves in dilute solutions of alkali hydroxides. |
| form |
Solid |
| pka |
pKa (25°) 4.7 |
| color |
Light yellow to Brown |
| biological source |
synthetic (organic) |
| Water Solubility |
Soluble in water, methanol, ethanol. |
| λmax |
327nm(0.05mol/L methanolic HCl)(lit.) |
| Merck |
14,8982 |
| Major Application |
forensics and toxicology
veterinary |
| Cosmetics Ingredients Functions |
ANTIOXIDANT |
| InChI |
1S/C20H17FO3S/c1-12-17(9-13-3-6-15(7-4-13)25(2)24)16-8-5-14(21)10-19(16)18(12)11-20(22)23/h3-10H,11H2,1-2H3,(H,22,23)/b17-9- |
| InChIKey |
MLKXDPUZXIRXEP-MFOYZWKCSA-N |
| SMILES |
CC1=C(CC(O)=O)c2cc(F)ccc2\C1=C/c3ccc(cc3)S(C)=O |
| CAS DataBase Reference |
38194-50-2(CAS DataBase Reference) |
| NIST Chemistry Reference |
Sulindac(38194-50-2) |
| EPA Substance Registry System |
1H-Indene-3-acetic acid, 5-fluoro-2-methyl-1-[[4-(methylsulfinyl)phenyl]methylene]-, (1Z)- (38194-50-2) |
