| Melting point |
166 °C |
| Boiling point |
482℃ |
| Density |
1.3915 (rough estimate) |
| refractive index |
1.6630 (estimate) |
| Flash point |
>110°(230°F) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
Practically insoluble in water, freely soluble in acetone, sparingly soluble in ethanol (96 per cent). It dissolves in dilute solutions of sodium hydroxide and in dilute acids. |
| pka |
pKa 5.60±0.05 (Uncertain) |
| form |
Solid |
| color |
White to Pale Yellow |
| Water Solubility |
Soluble in ethanol or acetone. Very slightly soluble in water |
| Sensitive |
Light Sensitive |
| Merck |
14,8918 |
| BRN |
6732984 |
| BCS Class |
2,4 |
| Stability |
Stable, but light sensitive. Incompatible with strong oxidizing agents. |
| Major Application |
forensics and toxicology
pharmaceutical (small molecule) |
| InChI |
1S/C10H11N3O3S/c1-7-6-10(12-16-7)13-17(14,15)9-4-2-8(11)3-5-9/h2-6H,11H2,1H3,(H,12,13) |
| InChIKey |
JLKIGFTWXXRPMT-UHFFFAOYSA-N |
| SMILES |
Cc1cc(NS(=O)(=O)c2ccc(N)cc2)no1 |
| CAS DataBase Reference |
723-46-6(CAS DataBase Reference) |
| IARC |
3 (Vol. Sup 7, 79) 2001 |
| NIST Chemistry Reference |
Sulfanilamide, n1-(5-methyl-3-isoxazolyl)-(723-46-6) |
| EPA Substance Registry System |
Sulfamethoxazole (723-46-6) |
