| Melting point |
159-160°C |
| alpha |
D25 -39.4° (c = 0.701 in water); D20 -46.1° (c = 0.7 in water) |
| Density |
1.374±0.06 g/cm3(Predicted) |
| refractive index |
-46 ° (C=0.69, H2O) |
| storage temp. |
-20°C |
| solubility |
Soluble in water, sparingly soluble in ethanol (96 per cent), slightly soluble in methylene chloride. It shows polymorphism (5.9). |
| form |
Solid |
| pka |
9.47±0.10(Predicted) |
| color |
White |
| optical activity |
Consistent with structure |
| Water Solubility |
5-10 g/100 mL at 21 ºC |
| Henry's Law Constant |
4.3×109 mol/(m3Pa) at 25℃, HSDB (2015) |
| BCS Class |
1,3 |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI |
1S/C10H12N2O4/c1-6-4-12(10(15)11-9(6)14)8-3-2-7(5-13)16-8/h2-4,7-8,13H,5H2,1H3,(H,11,14,15)/t7-,8+/m0/s1 |
| InChIKey |
XNKLLVCARDGLGL-JGVFFNPUSA-N |
| SMILES |
CC1=CN([C@@H]2O[C@H](CO)C=C2)C(=O)NC1=O |
| CAS DataBase Reference |
3056-17-5(CAS DataBase Reference) |
| EPA Substance Registry System |
Thymidine, 2',3'-didehydro-3'-deoxy- (3056-17-5) |