| Melting point |
>300 °C(lit.) |
| Density |
1.2504 (rough estimate) |
| refractive index |
1.6470 (estimate) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
ethanol: soluble |
| form |
Crystalline Powder |
| color |
White to light yellow |
| λmax |
499nm (MeOH); 496nm (H2O) |
| BRN |
4631860 |
| Stability |
Hygroscopic, Light Sensitive |
| Major Application |
Color filters; liquid crystal displays; dye lasers;electroluminescent displays;inks;light-emitting diode (LED);papermaking process; recording materials; solar cells; silica thin films;sol–gel titania films;waveguides |
| Biological Applications |
Detecting risk of Alzheimer’s disease and stroke;evaluating/testing sperm quality; identifying bacteria; as a substrate for measuring aromatase activity, azoreductase activity,phospholipase activity, proteases activity (caspase activity, cathepsin C activity, elastase activity proteinase activity);implantable drug-delivery devices |
| InChI |
InChI=1S/C20H14N2O3.ClH/c21-11-5-7-15-17(9-11)25-18-10-12(22)6-8-16(18)19(15)13-3-1-2-4-14(13)20(23)24;/h1-10H,21-22H2;1H |
| InChIKey |
MYIOYATURDILJN-UHFFFAOYSA-N |
| SMILES |
C(C1C=CC=CC=1C1C2=CC=C(N)C=C2[O+]=C2C=C(N)C=CC=12)(=O)O.[Cl-] |
| CAS DataBase Reference |
13558-31-1(CAS DataBase Reference) |
| EPA Substance Registry System |
Xanthylium, 3,6-diamino-9-(2-carboxyphenyl)-, chloride (13558-31-1) |