| Melting point |
96°C |
| Boiling point |
362.8±45.0 °C(Predicted) |
| Density |
1.15 |
| vapor pressure |
2.2 x l0-5 Pa (25 °C) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
DMSO: 130 mg/mL (652.45 mM) |
| pka |
3.52 |
| form |
Solid |
| color |
White to off-white |
| Water Solubility |
0.121 g/L (25 ºC) |
| BRN |
151589 |
| Henry's Law Constant |
3.4×102 mol/(m3Pa) at 25℃, Feigenbrugel and Calvé (2021) |
| Major Application |
agriculture environmental |
| InChI |
InChI=1S/C12H13N3/c1-9-8-10(2)14-12(13-9)15-11-6-4-3-5-7-11/h3-8H,1-2H3,(H,13,14,15) |
| InChIKey |
ZLIBICFPKPWGIZ-UHFFFAOYSA-N |
| SMILES |
C1(NC2=CC=CC=C2)=NC(C)=CC(C)=N1 |
| CAS DataBase Reference |
53112-28-0(CAS DataBase Reference) |
| EPA Substance Registry System |
Pyrimethanil (53112-28-0) |