| Melting point |
211-214°C |
| Boiling point |
633.2±65.0 °C(Predicted) |
| Density |
1.62±0.1 g/cm3(Predicted) |
| storage temp. |
Sealed in dry,Store in freezer, under -20°C |
| solubility |
1 M NaOH: soluble25ML, clear, colorless (Solvent: 1 mg + 25 mL of NaOH) |
| pka |
5.85±0.40(Predicted) |
| form |
White to yellow crystalline solid. |
| color |
Off-White to Pale Yellow |
| λmax |
276nm(H2O)(lit.) |
| Merck |
14,7908 |
| InChI |
InChI=1S/C21H20FN3O6S/c1-10-16(31-21(29)30-10)9-23-3-5-24(6-4-23)15-8-14-12(7-13(15)22)18(26)17(20(27)28)19-25(14)11(2)32-19/h7-8,11H,3-6,9H2,1-2H3,(H,27,28) |
| InChIKey |
PWNMXPDKBYZCOO-UHFFFAOYSA-N |
| SMILES |
N12C(C)SC1=C(C(O)=O)C(=O)C1=C2C=C(N2CCN(CC3=C(C)OC(=O)O3)CC2)C(F)=C1 |
| CAS DataBase Reference |
123447-62-1(CAS DataBase Reference) |