| Melting point |
230-240° (dec) |
| storage temp. |
0-6°C |
| solubility |
Solubilities in organic solvents (g/l at 20 °C) Dimethylsulfoxide: 190 Poly(ethylene glycol): 5.2 Acetonitrile: 0.9 2‐Propanol: <0.1 Xylene: <0.1 |
| pka |
The free acid produced by protonation under acidic conditions has a pKa of 2.1 (at 20 °C) |
| Water Solubility |
Solubility in water (at 20 °C) : Unbuffered water and buffered between pH 7 and 9: 42 g/l. Solubility is not influenced by pH in the range pH 7-9. Solubility at pH 4.5: 2.9 g/l |
| Stability |
Hygroscopic |
| InChI |
InChI=1S/C15H18N4O7S.Na/c1-4-9-26-14-16-19(15(22)18(14)2)13(21)17-27(23,24)11-8-6-5-7-10(11)12(20)25-3;/h5-8H,4,9H2,1-3H3,(H,17,21);/q;+1/p-1 |
| InChIKey |
JRQGDDUXDKCWRF-UHFFFAOYSA-M |
| SMILES |
N1(N=C(OCCC)N(C)C1=O)C(=O)N([Na])S(=O)(=O)C1=CC=CC=C1C(OC)=O |
| CAS DataBase Reference |
181274-15-7 |
| EPA Substance Registry System |
Propoxycarbazone-sodium (181274-15-7) |
