| Melting point |
37-38° |
| Boiling point |
bp0.1 159-162° |
| Density |
1.0117 (rough estimate) |
| refractive index |
nD20 1.5298 |
| storage temp. |
2-8°C |
| solubility |
Slightly soluble in water, very soluble in acetone and in ethanol (96 per cent). |
| pka |
pKa 7.32 or 7.89 (Uncertain) |
| form |
Solid |
| color |
White to off-white |
| Water Solubility |
6.169g/L(25 ºC) |
| Major Application |
pharmaceutical (small molecule) |
| InChI |
InChI=1S/C13H20N2O/c1-4-9-14-11(3)13(16)15-12-8-6-5-7-10(12)2/h5-8,11,14H,4,9H2,1-3H3,(H,15,16) |
| InChIKey |
MVFGUOIZUNYYSO-UHFFFAOYSA-N |
| SMILES |
C(NC1=CC=CC=C1C)(=O)C(NCCC)C |
| CAS DataBase Reference |
721-50-6(CAS DataBase Reference) |
| NIST Chemistry Reference |
Propanamide, n-(2-methylphenyl)-2-(propylamino)-(721-50-6) |