| Melting point |
276°C |
| Boiling point |
569.6±50.0 °C(Predicted) |
| Density |
1.270±0.06 g/cm3(Predicted) |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
Solubility Insoluble in water; soluble in ethanol, acetone |
| pka |
9.7(at 25℃) |
| form |
powder |
| color |
Pale yellow or cream-colored |
| PH Range |
Colorless (9.0) to indigo-blue (10.5) |
| BRN |
346799 |
| Major Application |
Inks, detergent, photoresist, toothpaste and mouthwash, disinfectant, cosmetics, paints |
| InChI |
InChI=1S/C24H22O4/c1-13-11-21(25)15(3)9-19(13)24(20-10-16(4)22(26)12-14(20)2)18-8-6-5-7-17(18)23(27)28-24/h5-12,25-26H,1-4H3 |
| InChIKey |
PXCIPOXPHMTCIL-UHFFFAOYSA-N |
| SMILES |
C1(=O)C2=C(C=CC=C2)C(C2=CC(C)=C(O)C=C2C)(C2=CC(C)=C(O)C=C2C)O1 |