| Melting point |
221° (van der Merwe) |
| alpha |
D -35° (c = 0.15 in ethanol) |
| Boiling point |
632.4±55.0 °C(Predicted) |
| Density |
1.361±0.06 g/cm3(Predicted) |
| Flash point |
-11 °C |
| storage temp. |
2-8°C |
| solubility |
DMF: 10 mg/ml; DMSO: 15 mg/ml; Ethanol: 50 mg/ml; Ethanol:PBS (pH 7.2) (1:1): 0.50 mg/ml |
| form |
A crystalline solid |
| pka |
3.40±0.10(Predicted) |
| color |
White to off-white |
| Major Application |
cleaning products
cosmetics
food and beverages
personal care |
| InChI |
1S/C20H19NO6/c1-11-9-13-7-8-14(17(22)16(13)20(26)27-11)18(23)21-15(19(24)25)10-12-5-3-2-4-6-12/h2-8,11,15,22H,9-10H2,1H3,(H,21,23)(H,24,25)/t11-,15+/m1/s1 |
| InChIKey |
DAEYIVCTQUFNTM-ABAIWWIYSA-N |
| SMILES |
C[C@@H]1Cc2ccc(C(=O)N[C@@H](Cc3ccccc3)C(O)=O)c(O)c2C(=O)O1 |
| EPA Substance Registry System |
L-Phenylalanine, N-[[(3R)-3,4-dihydro-8-hydroxy-3-methyl-1-oxo-1H-2-benzopyran-7-yl]carbonyl]- (4825-86-9) |
