| Melting point |
230 °C |
| Boiling point |
384.06°C (rough estimate) |
| Density |
1.0944 (rough estimate) |
| refractive index |
1.5200 (estimate) |
| storage temp. |
2-8°C |
| solubility |
Practically insoluble in water, slightly soluble in ethanol (96 per cent) and in methylene chloride. It dissolves in dilute solutions of alkali hydroxides |
| form |
Solid |
| pka |
4.2(at 25℃) |
| color |
White to Pale Yellow |
| Water Solubility |
It is soluble in acetone, chloroform, dichloromethane, methanol. Insoluble in water. |
| Merck |
14,5798 |
| Major Application |
forensics and toxicology
pharmaceutical (small molecule)
veterinary |
| InChI |
1S/C15H15NO2/c1-10-6-5-9-13(11(10)2)16-14-8-4-3-7-12(14)15(17)18/h3-9,16H,1-2H3,(H,17,18) |
| InChIKey |
HYYBABOKPJLUIN-UHFFFAOYSA-N |
| SMILES |
Cc1cccc(Nc2ccccc2C(O)=O)c1C |
| LogP |
5.120 |
| CAS DataBase Reference |
61-68-7(CAS DataBase Reference) |
| NIST Chemistry Reference |
Mefenamic acid(61-68-7) |
