| Melting point |
222.8°C |
| Boiling point |
397.76°C (rough estimate) |
| Density |
1.5300 |
| refractive index |
1.5376 (estimate) |
| storage temp. |
2-8°C |
| solubility |
Freely but slowly soluble in water, practically insoluble in ethanol (96 per cent). |
| form |
Powder |
| pka |
12.39±0.20(Predicted) |
| color |
White to Off-white |
| Odor |
Mildly sweet taste. |
| optical activity |
Alpha form +85.0 → +52.6 Beta form +34.9 → +55.4 |
| Water Solubility |
5-10 g/100 mL at 20 ºC |
| BRN |
93796 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Major Application |
cleaning products cosmetics food and beverages personal care pharmaceutical (small molecule) |
| Cosmetics Ingredients Functions |
SKIN CONDITIONING HUMECTANT |
| InChI |
1S/C12H22O11/c13-1-4(16)7(18)11(5(17)2-14)23-12-10(21)9(20)8(19)6(3-15)22-12/h1,4-12,14-21H,2-3H2/t4-,5+,6+,7+,8-,9-,10+,11+,12-/m0/s1 |
| InChIKey |
DKXNBNKWCZZMJT-JVCRWLNRSA-N |
| SMILES |
OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)[C@H](O)[C@@H](O)C=O |
| LogP |
-3.391 (est) |
| CAS DataBase Reference |
63-42-3(CAS DataBase Reference) |
| NIST Chemistry Reference |
D-Glucose, 4-o-«beta»-D-galactopyranosyl-(63-42-3) |
| EPA Substance Registry System |
Lactose (63-42-3) |