| Melting point |
100-123 °C |
| Boiling point |
199℃[at 101 325 Pa] |
| Density |
1.168[at 20℃] |
| vapor pressure |
6.5Pa at 20℃ |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
H2O: 0.1 M at 20 °C, clear, colorless |
| form |
Shiny Crystalline Flakes or Powder |
| color |
White |
| PH |
pH(0.25mol/l, 25℃) : 5.0～10.5 |
| Appearance |
White to Almost white powder to crystal. |
| Water Solubility |
Soluble in water. |
| BRN |
5186718 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C12H26O4S.Li/c1-2-3-4-5-6-7-8-9-10-11-12-16-17(13,14)15;/h2-12H2,1H3,(H,13,14,15);/q;+1/p-1 |
| InChIKey |
YFVGRULMIQXYNE-UHFFFAOYSA-M |
| SMILES |
C(COS([O-])(=O)=O)CCCCCCCCCC.[Li+] |
| CAS DataBase Reference |
2044-56-6(CAS DataBase Reference) |
| EPA Substance Registry System |
Sulfuric acid, monododecyl ester, lithium salt (2044-56-6) |
| Absorption |
≤0.05 at 260nm (3% solution)
≤0.05 at 280nm (3% solution) |
