Lithium dodecyl sulfate
- Product NameLithium dodecyl sulfate
- CAS2044-56-6
- CBNumberCB0150488
- MFC12H25LiO4S
- MW272.33
- EINECS218-058-2
- MDL NumberMFCD00007467
- MOL File2044-56-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 100-123 °C |
| Boiling point | 199℃[at 101 325 Pa] |
| Density | 1.168[at 20℃] |
| vapor pressure | 6.5Pa at 20℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | H2O: 0.1 M at 20 °C, clear, colorless |
| form | Shiny Crystalline Flakes or Powder |
| color | White |
| PH | pH(0.25mol/l, 25℃) : 5.0～10.5 |
| Appearance | White to Almost white powder to crystal. |
| Water Solubility | Soluble in water. |
| BRN | 5186718 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C12H26O4S.Li/c1-2-3-4-5-6-7-8-9-10-11-12-16-17(13,14)15;/h2-12H2,1H3,(H,13,14,15);/q;+1/p-1 |
| InChIKey | YFVGRULMIQXYNE-UHFFFAOYSA-M |
| SMILES | C(COS([O-])(=O)=O)CCCCCCCCCC.[Li+] |
| CAS DataBase Reference | 2044-56-6(CAS DataBase Reference) |
| EPA Substance Registry System | Sulfuric acid, monododecyl ester, lithium salt (2044-56-6) |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H228-H315-H318-H335 | |||||||||
| Precautionary statements | P210-P280-P302+P352-P305+P351+P338+P310 | |||||||||
| Hazard Codes | Xi,C,F | |||||||||
| Risk Statements | 36/37/38-34-20/21/22-15-14-11-41-37/38 | |||||||||
| Safety Statements | 26-36-45-43-36/37/39-16-7/8-3/7/9-39 | |||||||||
| RIDADR | UN1325 - class 4.1 - PG 3 - Flammable solids, organic, n.o.s., HI: all | |||||||||
| WGK Germany | 3 | |||||||||
| F | 3 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 4.1 | |||||||||
| HS Code | 29209010 | |||||||||
| Storage Class | 4.1B - Flammable solid hazardous materials | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Eye Dam. 1 Flam. Sol. 1 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
