| Melting point |
141-143 °C(lit.) |
| Boiling point |
325.09°C (rough estimate) |
| Density |
1.2077 (rough estimate) |
| refractive index |
1.5740 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
ethanol: soluble10mg/mL, clear, light yellow to yellow |
| pka |
4.81±0.10(Predicted) |
| Colour Index |
75490 |
| form |
Solid |
| color |
Yellow to Dark Yellow |
| Merck |
13,5382 |
| InChI |
InChI=1S/C15H14O3/c1-9(2)7-8-12-13(16)10-5-3-4-6-11(10)14(17)15(12)18/h3-7,18H,8H2,1-2H3 |
| InChIKey |
CIEYTVIYYGTCCI-UHFFFAOYSA-N |
| SMILES |
C1(=O)C2=C(C=CC=C2)C(=O)C(C/C=C(/C)\C)=C1O |
| LogP |
2.516 (est) |
| CAS DataBase Reference |
84-79-7 |
