| Melting point |
254-255 °C (dec.)(lit.) |
| Boiling point |
283.16°C (rough estimate) |
| Density |
1.523 |
| refractive index |
1.5090 (estimate) |
| storage temp. |
Sealed in dry,2-8°C |
| solubility |
DMSO (Slightly), Water (Slightly, Heated, Sonicated) |
| pka |
2.82±0.20(Predicted) |
| form |
Powder |
| color |
White to off-white |
| Water Solubility |
Soluble in water (partly), and dimethyl formamide. |
| InChI |
InChI=1S/C5H6N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h2H,1H2,(H,9,10)(H2,6,7,8,11)/t2-/m0/s1 |
| InChIKey |
UFIVEPVSAGBUSI-REOHCLBHSA-N |
| SMILES |
C1(=O)NC(=O)C[C@@H](C(O)=O)N1 |
| CAS DataBase Reference |
5988-19-2(CAS DataBase Reference) |
| NIST Chemistry Reference |
Orotic acid, dihydro-, l-(5988-19-2) |
