L-Dihydroorotic acid
- Product NameL-Dihydroorotic acid
- CAS5988-19-2
- MFC5H6N2O4
- MW158.11
- EINECS624-952-7
- MOL File5988-19-2.mol
Chemical Properties
| Melting point | 254-255 °C (dec.)(lit.) |
| Boiling point | 283.16°C (rough estimate) |
| Density | 1.523 |
| refractive index | 1.5090 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO (Slightly), Water (Slightly, Heated, Sonicated) |
| pka | 2.82±0.20(Predicted) |
| form | Powder |
| color | White to off-white |
| Water Solubility | Soluble in water (partly), and dimethyl formamide. |
| InChI | InChI=1S/C5H6N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h2H,1H2,(H,9,10)(H2,6,7,8,11)/t2-/m0/s1 |
| InChIKey | UFIVEPVSAGBUSI-REOHCLBHSA-N |
| SMILES | C1(=O)NC(=O)C[C@@H](C(O)=O)N1 |
| CAS DataBase Reference | 5988-19-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Orotic acid, dihydro-, l-(5988-19-2) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |