| Melting point |
>300 °C (dec.)(lit.) |
| alpha |
D21 +44° (0.28 g in 10 ml 0.5N HCl) |
| Boiling point |
358.94°C (rough estimate) |
| Density |
1.272±0.06 g/cm3 (20 ºC 760 Torr) |
| refractive index |
65 ° (C=1, 0.5mol/L NaOH) |
| storage temp. |
under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility |
H2O : 2 mg/mL (9.16 mM; ultrasonic and adjust pH to 10 with NaOH) |
| form |
Cryst. |
| pka |
2.32±0.10(Predicted) |
| color |
Off-white to light yellow |
| optical activity |
[α]20/D +65°, c = 1 in 0.5 M NaOH |
| Merck |
14,10 |
| BRN |
86638 |
| Major Application |
peptide synthesis |
| InChI |
InChI=1S/C12H14N2O2/c1-13-11(12(15)16)6-8-7-14-10-5-3-2-4-9(8)10/h2-5,7,11,13-14H,6H2,1H3,(H,15,16)/t11-/m0/s1 |
| InChIKey |
CZCIKBSVHDNIDH-NSHDSACASA-N |
| SMILES |
C(O)(=O)[C@H](CC1C2=C(C=CC=C2)NC=1)NC |
| CAS DataBase Reference |
526-31-8(CAS DataBase Reference) |