| Melting point |
112-114 °C(lit.) |
| Boiling point |
417.3°C (rough estimate) |
| Density |
1.1230 (rough estimate) |
| refractive index |
6.5 ° (C=2, EtOH) |
| storage temp. |
Keep in dark place,Inert atmosphere,2-8°C |
| solubility |
soluble in Methanol |
| form |
powder to crystal |
| pka |
14.82±0.46(Predicted) |
| color |
White to Light yellow to Light orange |
| optical activity |
[α]20/D +45°, c = 0.5 in chloroform |
| Water Solubility |
1.47g/L(28 ºC) |
| InChI |
InChI=1S/C15H18N2O3/c1-3-20-15(19)14(17-10(2)18)8-11-9-16-13-7-5-4-6-12(11)13/h4-7,9,14,16H,3,8H2,1-2H3,(H,17,18)/t14-/m0/s1 |
| InChIKey |
KQGQONPKSKUHHT-AWEZNQCLSA-N |
| SMILES |
C(OCC)(=O)[C@H](CC1C2=C(C=CC=C2)NC=1)NC(C)=O |
| CAS DataBase Reference |
2382-80-1(CAS DataBase Reference) |
