| Melting point |
150-151°C |
| Boiling point |
448.7±45.0 °C(Predicted) |
| Density |
1.352±0.06 g/cm3(Predicted) |
| storage temp. |
Sealed in dry,2-8°C |
| solubility |
Soluble in acetone and chloroform; |
| form |
powder to crystal |
| color |
Light yellow to Yellow to Green |
| Water Solubility |
practically insoluble in water |
| λmax |
268nm(MeOH)(lit.) |
| BRN |
262337 |
| InChI |
InChI=1S/C13H10O5/c1-15-10-7-3-4-9(14)18-12(7)13(16-2)11-8(10)5-6-17-11/h3-6H,1-2H3 |
| InChIKey |
DFMAXQKDIGCMTL-UHFFFAOYSA-N |
| SMILES |
C1(=O)OC2=C(OC)C3OC=CC=3C(OC)=C2C=C1 |
| LogP |
1.407 (est) |
| CAS DataBase Reference |
482-27-9(CAS DataBase Reference) |
