| Melting point |
265-268°C |
| alpha |
D25 +17 ±2.5° (c = 0.1 in ethanol) |
| Boiling point |
747.3±70.0 °C(Predicted) |
| Density |
2.17±0.1 g/cm3(Predicted) |
| storage temp. |
2-8°C |
| solubility |
DMF: 20 mg/mL, clear, faintly yellow |
| form |
Powder |
| pka |
13.05±0.70(Predicted) |
| color |
White to Pale Yellow |
| Water Solubility |
Soluble in DMF, DMSO, methanol or ethanol. Sparingly soluble in water |
| Merck |
13,4152 |
| BRN |
1225932 |
| Stability |
Stable for 1 year from date of purchase as supplied. Solutions in DMSO may be stored at -20°C for up to 3 months. |
| InChI |
InChI=1/C10H12FN5O4/c11-10-14-7(12)4-8(15-10)16(2-13-4)9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1H2,(H2,12,14,15)/t3-,5-,6+,9-/s3 |
| InChIKey |
HBUBKKRHXORPQB-VOSPVXAENA-N |
| SMILES |
C12N=C(N=C(N)C=1N=CN2[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O1)F |&1:10,11,13,15,r| |
| CAS DataBase Reference |
21679-14-1(CAS DataBase Reference) |
