| Melting point |
224.4-226.80C |
| alpha |
D25 +7.5° (ethanol); D25 +21.9° (chloroform) |
| Boiling point |
473.76°C (rough estimate) |
| Density |
1.0909 (rough estimate) |
| refractive index |
1.5614 (estimate) |
| storage temp. |
-20°C Freezer |
| solubility |
Acetonitrile (Slightly), Chloroform (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| form |
Solid |
| pka |
13.10±0.60(Predicted) |
| color |
White to Pale Yellow |
| Water Solubility |
Partly soluble in water. Soluble in chloroform (25 mg/ml), acetone, acetonitrile, and ethanol. 17beta-Hydroxy-2,4,17a-pregnadien-20-yno[2,3-d]isoxazole and 2,4,17a-Pregnadien-20-yno[2,3-d]isoxazol-17-ol are the synonym of this compound. |
| InChIKey |
POZRVZJJTULAOH-QLPJIZEUNA-N |
| SMILES |
[C@]12([H])CC[C@]3(C)[C@](CC[C@@]3([H])[C@]1([H])CCC1=CC3ON=CC=3C[C@]21C)(O)C#C |&1:0,4,6,9,11,23,r| |
| EPA Substance Registry System |
Danazol (17230-88-5) |
