| Melting point |
164-166°C |
| alpha |
D22 -33.9° (c = 3 in methanol) |
| Boiling point |
654.9±55.0 °C(Predicted) |
| Density |
1.334±0.06 g/cm3(Predicted) |
| storage temp. |
2-8°C |
| solubility |
Soluble in DMSO (up to 25 mg/ml) or in Ethanol (up to 15 mg/ml) |
| pka |
9.72±0.30(Predicted) |
| form |
powder |
| color |
White or off-white |
| optical activity |
-28.9314°(C=1.0022g/100ml MEOH) |
| BCS Class |
2 |
| Stability |
Stable for 2 years from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20°C for up to 3 months. |
| InChI |
InChI=1S/C24H21F2NO3/c25-17-5-1-15(2-6-17)22(29)14-13-21-23(16-3-11-20(28)12-4-16)27(24(21)30)19-9-7-18(26)8-10-19/h1-12,21-23,28-29H,13-14H2/t21-,22+,23-/m1/s1 |
| InChIKey |
OLNTVTPDXPETLC-XPWALMASSA-N |
| SMILES |
N1(C2=CC=C(F)C=C2)[C@H](C2=CC=C(O)C=C2)[C@@H](CC[C@@H](C2=CC=C(F)C=C2)O)C1=O |
| CAS DataBase Reference |
163222-33-1(CAS DataBase Reference) |
| EPA Substance Registry System |
2-Azetidinone, 1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(4-hydroxyphenyl)-, (3R,4S)- (163222-33-1) |