| storage temp. |
-20°C |
| solubility |
H2O: 20 mg/mL, clear, yellow |
| form |
Yellow solid. |
| color |
off-white |
| biological source |
microbial |
| Water Solubility |
water: 20mg/mL, clear, faintly yellow to yellow |
| BRN |
873543 |
| Stability |
Stable for 1 year from date of purchase as supplied. Solutions in DMSO or distilled water may be stored at -20°C for up to 1 month. |
| InChIKey |
IJWCGVPEDDQUDE-YGJAXBLXSA-N |
| SMILES |
[H]C(=O)[C@H](C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)N[C@@H](CC(C)C)C(O)=O)[C@]1([H])CCNC(=N)N1 |
