| Melting point |
99°C |
| Boiling point |
200 °C / 12mmHg |
| Density |
0.9216 (rough estimate) |
| refractive index |
1.4287 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| Water Solubility |
Insoluble in water |
| form |
powder to crystal |
| pka |
16.62±0.40(Predicted) |
| color |
White to Almost white |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C12H25NO/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H2,13,14) |
| InChIKey |
ILRSCQWREDREME-UHFFFAOYSA-N |
| SMILES |
C(N)(=O)CCCCCCCCCCC |
| LogP |
4.235 (est) |
| CAS DataBase Reference |
1120-16-7(CAS DataBase Reference) |
| NIST Chemistry Reference |
Dodecanamide(1120-16-7) |
| EPA Substance Registry System |
Dodecanamide (1120-16-7) |
