| Melting point |
144-147 °C |
| Boiling point |
353°C [760mmHg] |
| Density |
0.87 |
| vapor density |
>1 (vs air) |
| vapor pressure |
0Pa at 25℃ |
| Flash point |
129 °F |
| storage temp. |
Inert atmosphere,Room Temperature |
| form |
Powder |
| pka |
12.06±0.53(Predicted) |
| color |
white |
| Water Solubility |
reacts |
| Sensitive |
Air & Light Sensitive |
| Hydrolytic Sensitivity |
4: no reaction with water under neutral conditions |
| BRN |
2523445 |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI |
1S/C12H12O2Si/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13-14H |
| InChIKey |
OLLFKUHHDPMQFR-UHFFFAOYSA-N |
| SMILES |
O[Si](O)(c1ccccc1)c2ccccc2 |
| LogP |
2 at 20℃ |
| CAS DataBase Reference |
947-42-2(CAS DataBase Reference) |
| NIST Chemistry Reference |
Diphenyl silanediol(947-42-2) |
| EPA Substance Registry System |
Silanediol, diphenyl- (947-42-2) |
