| Melting point |
−17 °C (1 °F; 256 K) |
| Boiling point |
204 to 207 °C (399 to 405 °F; 477 to 480 K) |
| Density |
1.15 g/cm3 |
| vapor pressure |
48Pa at 25℃ |
| refractive index |
1.44 |
| Flash point |
95 °C (203 °F; 368 K) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
water: soluble77.9g/L at 20°C |
| form |
clear oily liquid |
| color |
colorless |
| Odor |
mild char. odor |
| Water Solubility |
Miscible with water. |
| Specific Heat Capacity |
Cp(liquid): 1.83 J/(g·K), at 25℃ |
| BRN |
471705 |
| Henry's Law Constant |
1.4×101 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) |
| Stability |
Stable. Combustible. Incompatible with acids, bases, reducing agents, strong oxidizing agents. |
| Cosmetics Ingredients Functions |
SOLVENT
SKIN CONDITIONING - EMOLLIENT |
| InChI |
1S/C6H8O4/c1-9-5(7)3-4-6(8)10-2/h3-4H,1-2H3/b4-3- |
| InChIKey |
LDCRTTXIJACKKU-ARJAWSKDSA-N |
| SMILES |
[H]\C(=C(/[H])C(=O)OC)C(=O)OC |
| LogP |
0.52 at 35℃ |
| CAS DataBase Reference |
624-48-6(CAS DataBase Reference) |
| NIST Chemistry Reference |
2-Butenedioic acid (Z)-, dimethyl ester(624-48-6) |
| EPA Substance Registry System |
2-Butenedioic acid (2Z)-, dimethyl ester (624-48-6) |
