Dimethyl maleate
- Product NameDimethyl maleate
- CAS624-48-6
- CBNumberCB4854003
- MFC6H8O4
- MW144.13
- EINECS210-848-5
- MDL NumberMFCD00008459
- MOL File624-48-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | -19°C |
| Boiling point | 204-205 °C(lit.) |
| Density | 1.152 g/mL at 25 °C(lit.) |
| vapor pressure | 48Pa at 25℃ |
| refractive index | n |
| Flash point | 196 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | water: soluble77.9g/L at 20°C |
| form | Liquid |
| color | Clear |
| Odor | mild char. odor |
| Water Solubility | Miscible with water. |
| BRN | 471705 |
| Stability | Stable. Combustible. Incompatible with acids, bases, reducing agents, strong oxidizing agents. |
| Cosmetics Ingredients Functions | SOLVENT SKIN CONDITIONING - EMOLLIENT |
| InChI | 1S/C6H8O4/c1-9-5(7)3-4-6(8)10-2/h3-4H,1-2H3/b4-3- |
| InChIKey | LDCRTTXIJACKKU-ARJAWSKDSA-N |
| SMILES | [H]\C(=C(/[H])C(=O)OC)C(=O)OC |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H317-H319-H335-H373 | |||||||||
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338-P314 | |||||||||
| Hazard Codes | Xn,C | |||||||||
| Risk Statements | 21/22-36/37/38-43-37-34-22 | |||||||||
| Safety Statements | 26-36/37-23-45-36/37/39 | |||||||||
| RIDADR | UN 2810 6.1/PG 3 | |||||||||
| WGK Germany | 1 | |||||||||
| RTECS | EM6300000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 6.1(b) | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29171990 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 4 Oral Eye Irrit. 2 Skin Sens. 1 STOT RE 2 Dermal STOT SE 3 | |||||||||
| NFPA 704: |
|
