| Boiling point |
150 °C12 mm Hg(lit.) |
| Density |
0.945 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.433(lit.) |
| Flash point |
>230 °F |
| storage temp. |
Sealed in dry,Room Temperature |
| form |
clear liquid |
| color |
Colorless to Almost colorless |
| BRN |
518421 |
| Stability |
Stable. Incompatible with bases, strong oxidizing agents. Combustible. |
| InChI |
InChI=1S/C15H28O4/c1-5-9-11-15(12-10-6-2,13(16)18-7-3)14(17)19-8-4/h5-12H2,1-4H3 |
| InChIKey |
WHKKUUPZLWUOIW-UHFFFAOYSA-N |
| SMILES |
C(OCC)(=O)C(CCCC)(CCCC)C(OCC)=O |
| CAS DataBase Reference |
596-75-8(CAS DataBase Reference) |
| NIST Chemistry Reference |
Propanedioic acid, dibutyl-, diethyl ester(596-75-8) |
| EPA Substance Registry System |
Propanedioic acid, dibutyl-, diethyl ester (596-75-8) |
