| Melting point |
233-235 °C (subl.) (lit.) |
| Density |
1.6151 (estimate) |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| solubility |
soluble in Methanol |
| form |
Powder |
| color |
White to light cream-yellow |
| Water Solubility |
Soluble in water and methanol. |
| Sensitive |
Light Sensitive |
| Merck |
14,7464 |
| BRN |
3574977 |
| InChI |
InChI=1S/C12H10I.ClH/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h1-10H;1H/q+1;/p-1 |
| InChIKey |
RSJLWBUYLGJOBD-UHFFFAOYSA-M |
| SMILES |
[I+](C1C=CC=CC=1)C1C=CC=CC=1.[Cl-] |
| CAS DataBase Reference |
1483-72-3(CAS DataBase Reference) |
| EPA Substance Registry System |
Iodonium, diphenyl-, chloride (1483-72-3) |