| Melting point |
256-258°C |
| Boiling point |
576.7±50.0 °C(Predicted) |
| Density |
1.512±0.06 g/cm3(Predicted) |
| vapor pressure |
0Pa at 20℃ |
| storage temp. |
Sealed in dry,2-8°C |
| solubility |
Soluble in acetonitrile, DMSO (60 mg/ml), and ethanol (17 mg/ml), clear, light yellow to yellow. |
| pka |
6.50±0.40(Predicted) |
| form |
Solid |
| color |
light yellow to yellow |
| Water Solubility |
19μg/L at 20℃ |
| BRN |
294492 |
| Henry's Law Constant |
3.3×1012 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability |
Hygroscopic |
| Major Application |
metabolomics vitamins, nutraceuticals, and natural products |
| Cosmetics Ingredients Functions |
SKIN CONDITIONING |
| InChI |
1S/C16H12O6/c1-21-13-3-2-8(4-10(13)18)14-7-12(20)16-11(19)5-9(17)6-15(16)22-14/h2-7,17-19H,1H3 |
| InChIKey |
MBNGWHIJMBWFHU-UHFFFAOYSA-N |
| SMILES |
COc1ccc(cc1O)C2=CC(=O)c3c(O)cc(O)cc3O2 |
| LogP |
3.1 at 20℃ |
| CAS DataBase Reference |
520-34-3(CAS DataBase Reference) |