| Melting point |
20.2 °C |
| Melting point |
18,45°C |
| Boiling point |
189°C |
| Boiling point |
55 °C5 mm Hg(lit.) |
| Density |
1.190 g/mL at 25 °C(lit.) |
| Density |
d = 1,19 |
| vapor pressure |
0.42 mm Hg ( 20 °C) |
| refractive index |
n20/D 1.476(lit.) |
| Flash point |
185 °F |
| storage temp. |
no restrictions. |
| solubility |
Minimum isotopic purity 99.96% |
| form |
Liquid |
| color |
Colorless |
| Specific Gravity |
1.190 |
| explosive limit |
1.8-63%(V) |
| Water Solubility |
Miscible with water and with almost all organic solvents such as alcohols, esters, ketones, chlorinated solvents and aromatic hydrocarbons. |
| Sensitive |
Hygroscopic |
| BRN |
1237248 |
| Stability |
Stable. Combustible. Moisture sensitive. Incompatible with acid chlorides, strong acids, phosphorus halides, strong oxidizing agents, strong reducing agents. Reacts violently with a wide range of materials - consult a full MSDS sheet before starting use. |
| InChI |
1S/C2H6OS/c1-4(2)3/h1-2H3/i1D3,2D3 |
| InChIKey |
IAZDPXIOMUYVGZ-WFGJKAKNSA-N |
| SMILES |
[2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| LogP |
-0.69 at 20℃ and pH7 |
| CAS DataBase Reference |
2206-27-1(CAS DataBase Reference) |
