| Melting point |
119-122 °C (dec.)(lit.) |
| Boiling point |
232.96°C (rough estimate) |
| alpha |
-92.25 º (c=10,H2O,on dry sub.) |
| Density |
1.59 |
| bulk density |
700-800kg/m3 |
| refractive index |
-92 ° (C=4, H2O) |
| storage temp. |
room temp |
| solubility |
H2O: 1 M at 20 °C, clear, colorless |
| pka |
pKa (18°): 12.06 |
| form |
Crystals or Crystalline Powder |
| color |
White |
| PH |
5.0-7.0 (25℃, 0.1M in H2O) |
| Odor |
at 100.00 %. odorless |
| Odor Type |
odorless |
| biological source |
natural (organic) |
| optical activity |
[α]20/D 93.5 to 91.0°, c = 10% in H2O |
| Water Solubility |
3750 g/L (20 ºC) |
| λmax |
λ: 260 nm Amax: 0.04 λ: 280 nm Amax: 0.04 |
| Merck |
14,4273 |
| BRN |
1239004 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Major Application |
pharmaceutical (small molecule) |
| Cosmetics Ingredients Functions |
HUMECTANT |
| InChI |
1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5-,6-/m1/s1 |
| InChIKey |
LKDRXBCSQODPBY-GWVKGMJFSA-N |
| SMILES |
OC[C@@H](O)[C@@H](O)[C@H](O)C(=O)CO |
| LogP |
-1.029 (est) |
| CAS DataBase Reference |
57-48-7(CAS DataBase Reference) |
| NIST Chemistry Reference |
«beta»-D-Fructose(57-48-7) |
| EPA Substance Registry System |
D-Fructose (57-48-7) |