| Melting point |
208-210 °C(lit.) |
| alpha |
-24 º (c=1, 6N HCl) |
| Boiling point |
364.0±32.0 °C(Predicted) |
| Density |
1.333±0.06 g/cm3(Predicted) |
| refractive index |
-24 ° (C=1, 6mol/L HCl) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| pka |
2.49±0.24(Predicted) |
| form |
Powder or Crystalline Powder |
| color |
White to off-white |
| optical activity |
Consistent with structure |
| BRN |
1724347 |
| InChI |
InChI=1S/C6H11NO4/c7-4(6(10)11)2-1-3-5(8)9/h4H,1-3,7H2,(H,8,9)(H,10,11)/t4-/m1/s1 |
| InChIKey |
OYIFNHCXNCRBQI-SCSAIBSYSA-N |
| SMILES |
C(O)(=O)[C@H](N)CCCC(O)=O |
| CAS DataBase Reference |
7620-28-2(CAS DataBase Reference) |
