| Melting point |
135 °C |
| Boiling point |
56 °C760 mm Hg(lit.) |
| bulk density |
800-1000kg/m3 |
| Density |
0.791 g/mL at 25 °C(lit.) |
| vapor density |
2 (vs air) |
| vapor pressure |
184 mm Hg ( 20 °C) |
| refractive index |
n20/D 1.359(lit.) |
| Flash point |
1 °F |
| storage temp. |
no restrictions. |
| solubility |
Citric Acid Monohydrate is very soluble in water, freely soluble in ethanol and sparingly soluble in ether. |
| form |
Solid |
| pka |
3.138, 4.76, 6.401 |
| Specific Gravity |
0.810 (20/4℃) |
| color |
White |
| PH |
1.85 (50g/l, H2O, 25℃) |
| Odor |
Typical, practically odorless |
| Water Solubility |
1630 g/L (20 oC) ;H2O: soluble 54% (w/w) at 10°C (Citric acid in water) |
| Sensitive |
Hygroscopic |
| Merck |
14,2326 |
| BRN |
4018641 |
| Stability |
Stable. Incompatible with oxidizing agents, bases, reducing agents, nitrates. |
| Cosmetics Ingredients Functions |
CHELATING
BUFFERING
FRAGRANCE |
| InChI |
1S/C6H8O7.H2O/c7-3(8)1-6(13,5(11)12)2-4(9)10;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1H2 |
| InChIKey |
YASYEJJMZJALEJ-UHFFFAOYSA-N |
| SMILES |
OC(CC(O)(C(O)=O)CC(O)=O)=O.O |
| CAS DataBase Reference |
5949-29-1(CAS DataBase Reference) |
| NIST Chemistry Reference |
Citric acid monohydrate(5949-29-1) |
| EPA Substance Registry System |
1,2,3-Propanetricarboxylic acid, 2-hydroxy-, hydrate (1:1) (5949-29-1) |
