| Melting point |
400 °C |
| storage temp. |
room temp |
| solubility |
water: 1 mg/mL, clear, yellow to orange |
| pka |
pKa -3.0(H2O T=room temperature(RT) Iunspecied) (Uncertain);0.5(H2O T=room temperature(RT) Iunspecied) (Uncertain);8.9(H2O T=room temperature(RT) Iunspecied) (Uncertain) |
| Colour Index |
46025 |
| form |
crystalline powder |
| color |
Dark orange to brown crystalline powder |
| Water Solubility |
water: 1mg/mL, clear, yellow to orange |
| λmax |
442 nm |
| ε(extinction coefficient) |
44000 at 262-268nm |
| ex/em |
λex 460 nm; λem 492 nm in EtOH |
| Major Application |
diagnostic assay manufacturing
hematology
histology |
| InChI |
1S/C15H15N3.ClH/c1-8-3-10-5-11-4-9(2)13(17)7-15(11)18-14(10)6-12(8)16;/h3-7H,16-17H2,1-2H3;1H |
| InChIKey |
BGLGAKMTYHWWKW-UHFFFAOYSA-N |
| SMILES |
Cl[H].Cc1cc2cc3cc(C)c(N)cc3nc2cc1N |
| EPA Substance Registry System |
3,6-Acridinediamine, 2,7-dimethyl-, monohydrochloride (135-49-9) |
