| Melting point |
235 °C (dec.)(lit.) |
| Boiling point |
2262°C |
| Density |
1.2171 (rough estimate) |
| refractive index |
1.6110 (estimate) |
| storage temp. |
room temp |
| solubility |
Soluble in water, ethanol, acetone, methyl cellosolve, xylene; practically insoluble in Ibenzene |
| Colour Index |
11270 |
| form |
Crystalline Powder |
| color |
Bordeaux to deep purple |
| PH Range |
Orange (4.0) to yellow (7.0) |
| Odor |
Odorless |
| λmax |
449nm |
| Merck |
13,2279 |
| BRN |
3724653 |
| Major Application |
Recording materials, waveguides, thin solid films, photographic materials, printing plates, inks, toners, detergents, corrosion inhibitors, rubber, textiles, hair dyes |
| Cosmetics Ingredients Functions |
HAIR DYEING |
| InChI |
1S/C12H12N4.ClH/c13-9-6-7-12(11(14)8-9)16-15-10-4-2-1-3-5-10;/h1-8H,13-14H2;1H |
| InChIKey |
MCTQNEBFZMBRSQ-GEEYTBSJSA-N |
| SMILES |
Cl[H].Nc1ccc(N=Nc2ccccc2)c(N)c1 |
| CAS DataBase Reference |
532-82-1(CAS DataBase Reference) |
| IARC |
3 (Vol. 8, Sup 7) 1987 |
| EPA Substance Registry System |
C.I. Basic Orange 2, monohydrochloride (532-82-1) |
