| Melting point |
284-287 °C(lit.) |
| Density |
1.001 g/mL at 20 °C |
| refractive index |
n20/D 1.338 |
| storage temp. |
-20°C |
| solubility |
Soluble in water, ethanol, dimethyl sulfoxide |
| form |
Powder |
| pka |
-3.2, 10.5(at 25℃) |
| Colour Index |
46005 |
| color |
orange to red |
| Water Solubility |
H2O: 0.1%, clear, orange to red |
| ε(extinction coefficient) |
≥14,000 at 227-233nm in water at 0.005g/L ≥35000 at 265-271nm in water at 0.005g/L |
| λmax |
500 nm |
| ex/em |
λex 431, 307 nm; λem 520 nm in EtOH |
| BRN |
3734978 |
| Major Application |
Adhesives; aluminophosphate crystalline materials; detecting clay particles; display device; evaluating fiber surface characteristics; glass matrixes; imaging material; inks; lasers; recording materials; photoresists; textiles; thin films; tracers for hydrology; wiring boards |
| Biological Applications |
Detecting cancer cells,spores,human papilloma virus (HPV),stress biomarkers; treating amyloid associated diseases,lupus,pathogen infections; apoptosis assays; cytotoxicity assays |
| InChI |
1S/C17H19N3.ClH/c1-19(2)14-7-5-12-9-13-6-8-15(20(3)4)11-17(13)18-16(12)10-14;/h5-11H,1-4H3;1H |
| InChIKey |
VSTHNGLPHBTRMB-UHFFFAOYSA-N |
| SMILES |
Cl[H].CN(C)c1ccc2cc3ccc(cc3nc2c1)N(C)C |
| CAS DataBase Reference |
65-61-2 |
| EPA Substance Registry System |
C.I. Basic Orange 14 (65-61-2) |