| Melting point |
225--2290C |
| storage temp. |
Inert atmosphere,Store in freezer, under -20°C |
| solubility |
DMSO: >10mg/mL |
| form |
powder |
| color |
white to off-white |
| Merck |
14,906 |
| Stability |
Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C22H24ClN3O.ClH/c1-25-13-4-5-18(12-14-25)26-22(27)20-7-3-2-6-19(20)21(24-26)15-16-8-10-17(23)11-9-16;/h2-3,6-11,18H,4-5,12-15H2,1H3;1H |
| InChIKey |
YEJAJYAHJQIWNU-UHFFFAOYSA-N |
| SMILES |
C1(=O)C2=C(C=CC=C2)C(CC2=CC=C(Cl)C=C2)=NN1C1CCCN(C)CC1.[H]Cl |
| CAS DataBase Reference |
79307-93-0(CAS DataBase Reference) |