| Melting point |
206-208 °C(lit.) |
| Boiling point |
263.29°C (rough estimate) |
| Density |
0.9510 (rough estimate) |
| refractive index |
1.5220 (estimate) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
1 M HCl: soluble5%, clear to hazy, colorless to faint yellow or tan |
| form |
Powder |
| pka |
10.1(at 25℃) |
| color |
White to cream |
| Water Solubility |
Soluble in organic solvents. Insoluble in water. |
| Merck |
14,374 |
| BRN |
2204333 |
| Major Application |
food and beverages
personal care
pharmaceutical |
| InChI |
1S/C10H17N/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6,11H2/t7-,8+,9-,10- |
| InChIKey |
DKNWSYNQZKUICI-UHFFFAOYSA-N |
| SMILES |
NC12C[C@H]3C[C@H](C[C@H](C3)C1)C2 |
| CAS DataBase Reference |
768-94-5(CAS DataBase Reference) |
| NIST Chemistry Reference |
Tricyclo[3.3.1.13,7]decane-1-amine(768-94-5) |
| EPA Substance Registry System |
Tricyclo[3.3.1.13,7]decan-1-amine (768-94-5) |
