| Melting point |
209-212 °C (subl.) (lit.) |
| Boiling point |
185.55°C (rough estimate) |
| Density |
1,07 g/cm3 |
| refractive index |
1.5680 |
| storage temp. |
Store below +30°C. |
| solubility |
0.00021g/l slightly soluble |
| form |
Crystals or Crystalline Powder |
| color |
White to beige |
| Specific Gravity |
1.07 |
| Water Solubility |
Insoluble in water. |
| Merck |
14,149 |
| BRN |
1901173 |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI |
1S/C10H16/c1-7-2-9-4-8(1)5-10(3-7)6-9/h7-10H,1-6H2/t7-,8+,9-,10+ |
| InChIKey |
ORILYTVJVMAKLC-UHFFFAOYSA-N |
| SMILES |
C1[C@H]2C[C@H]3C[C@@H]1C[C@@H](C2)C3 |
| LogP |
4.240 |
| CAS DataBase Reference |
281-23-2(CAS DataBase Reference) |
| NIST Chemistry Reference |
Adamantane(281-23-2) |
| EPA Substance Registry System |
Tricyclo[3.3.1.13,7]decane (281-23-2) |
