| Melting point |
243°; mp 239-243° |
| alpha |
D16 -45.7° (c = 1.05 in 0.1N HCl) |
| Boiling point |
433.28°C (rough estimate) |
| Density |
1.3067 (rough estimate) |
| refractive index |
1.7000 (estimate) |
| storage temp. |
2-8°C |
| solubility |
DMSO: soluble0.90 - 1.10mg/mL, clear, colorless |
| form |
solid |
| pka |
12.31±0.70(Predicted) |
| color |
White or off-white |
| biological source |
Streptomyces rimosus |
| Stability |
Stable for 1 year from date of purchase as supplied. Solutions in DMSO may be stored at -20°C for up to 3 months. |
| InChI |
InChI=1/C12H13N5O4/c13-1-5-2-17(11-7(5)10(14)15-4-16-11)12-9(20)8(19)6(3-18)21-12/h2,4,6,8-9,12,18-20H,3H2,(H2,14,15,16)/t6-,8-,9-,12-/s3 |
| InChIKey |
XOKJUSAYZUAMGJ-SMUHWEKINA-N |
| SMILES |
N1(C=C(C#N)C2C(N)=NC=NC1=2)[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 |&1:12,13,15,17,r| |
![4-AMINO-5-CYANO-7-(BETA-D-RIBOFURANOSYL)PYRROLO[2,3-D]PYRIMIDINE](https://www.chemicalbook.com/CAS/GIF/606-58-6.gif)
