| Melting point |
275 °C (dec.)(lit.) |
| alpha |
-33 º (c=5, 5N HCl, dry sub) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
Aqueous Acid (Sparingly), Water (Slightly, Sonicated) |
| form |
Crystalline |
| color |
White to Off-White |
| optical activity |
Consistent with structure |
| Water Solubility |
35 g/L (20 ºC) |
| Merck |
14,837 |
| BRN |
1723526 |
| Stability |
Hygroscopic |
| Major Application |
peptide synthesis |
| InChI |
1S/C4H8N2O3.H2O/c5-2(4(8)9)1-3(6)7;/h2H,1,5H2,(H2,6,7)(H,8,9);1H2/t2-;/m1./s1 |
| InChIKey |
RBMGJIZCEWRQES-HSHFZTNMSA-N |
| SMILES |
NC(C[C@@H](N)C(O)=O)=O.[H]O[H] |
| CAS DataBase Reference |
5794-24-1(CAS DataBase Reference) |
