| Melting point |
224-226 °C (dec.)(lit.) |
| Density |
1.4025 (rough estimate) |
| refractive index |
1.6100 (estimate) |
| storage temp. |
Inert atmosphere,Store in freezer, under -20°C |
| solubility |
DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form |
Powder or Solid |
| pka |
pKa 3.31(H2O
t = 25
I = 0.1)(Approximate) |
| color |
White to off-white to pale brown |
| biological source |
synthetic (organic) |
| Water Solubility |
Soluble in DMSO, water, or methanol
/n |
| Merck |
7980 |
| BRN |
3632748 |
| Major Application |
vitamins, nutraceuticals, and natural products |
| InChI |
InChI=1S/C8H12N2O2.2ClH/c1-5-8(12)7(2-9)6(4-11)3-10-5;;/h3,11-12H,2,4,9H2,1H3;2*1H |
| InChIKey |
HNWCOANXZNKMLR-UHFFFAOYSA-N |
| SMILES |
C1(CN)=C(O)C(=NC=C1CO)C.Cl.Cl |
| CAS DataBase Reference |
524-36-7(CAS DataBase Reference) |